C21H28O4S — CID 23259831
[(1R,2S,3S,4R)-3-(benzenesulfonylmethyl)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (E)-but-2-enoate (PubChem CID 23259831) has the molecular formula C21H28O4S and a molecular weight of 376.52 g/mol. Its IUPAC name is [(1R,2S,3S,4R)-3-(benzenesulfonylmethyl)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (E)-but-2-enoate.
| Compound Name | [(1R,2S,3S,4R)-3-(benzenesulfonylmethyl)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 23259831 |
| Molecular Formula | C21H28O4S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [(1R,2S,3S,4R)-3-(benzenesulfonylmethyl)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)O[C@H]1[C@@H](CS(=O)(=O)c2ccccc2)[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C21H28O4S/c1-5-9-18(22)25-19-16(17-12-13-21(19,4)20(17,2)3)14-26(23,24)15-10-7-6-8-11-15/h5-11,16-17,19H,12-14H2,1-4H3/b9-5+/t16-,17+,19-,21-/m0/s1 |
| InChIKey | LGMJTHKHHFQORX-ZZPPCQKASA-N |
| XLogP | 4.02 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|