C19H26O7 — CID 23260056
[(1R,4S,5S,6S,10S,11R)-11-acetyloxy-4,5,10-trimethyl-3,8-dioxo-7-oxatricyclo[4.3.3.01,6]dodecan-5-yl]methyl acetate (PubChem CID 23260056) has the molecular formula C19H26O7 and a molecular weight of 366.41 g/mol. Its IUPAC name is [(1R,4S,5S,6S,10S,11R)-11-acetyloxy-4,5,10-trimethyl-3,8-dioxo-7-oxatricyclo[4.3.3.01,6]dodecan-5-yl]methyl acetate.
| Compound Name | [(1R,4S,5S,6S,10S,11R)-11-acetyloxy-4,5,10-trimethyl-3,8-dioxo-7-oxatricyclo[4.3.3.01,6]dodecan-5-yl]methyl acetate |
|---|---|
| PubChem CID | 23260056 |
| Molecular Formula | C19H26O7 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | [(1R,4S,5S,6S,10S,11R)-11-acetyloxy-4,5,10-trimethyl-3,8-dioxo-7-oxatricyclo[4.3.3.01,6]dodecan-5-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]1(C)[C@H](C)C(=O)C[C@]23CC(=O)O[C@@]21C[C@@H](OC(C)=O)[C@H]3C |
| InChI | InChI=1S/C19H26O7/c1-10-14(22)6-18-8-16(23)26-19(18,17(10,5)9-24-12(3)20)7-15(11(18)2)25-13(4)21/h10-11,15H,6-9H2,1-5H3/t10-,11-,15-,17-,18-,19-/m1/s1 |
| InChIKey | NZENUGYUUHOZGX-CZFSCGMASA-N |
| XLogP | 1.81 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|