C14H16O6 — CID 23260122
7-O-methyl 5-O-prop-2-enyl (1S,4S,5R)-5-methyl-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-5,7-dicarboxylate (PubChem CID 23260122) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is 7-O-methyl 5-O-prop-2-enyl (1S,4S,5R)-5-methyl-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-5,7-dicarboxylate.
| Compound Name | 7-O-methyl 5-O-prop-2-enyl (1S,4S,5R)-5-methyl-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-5,7-dicarboxylate |
|---|---|
| PubChem CID | 23260122 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 7-O-methyl 5-O-prop-2-enyl (1S,4S,5R)-5-methyl-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-5,7-dicarboxylate |
| SMILES | C=CCOC(=O)[C@]1(C)C[C@@H]2OC(=O)[C@H]1C=C2C(=O)OC |
| InChI | InChI=1S/C14H16O6/c1-4-5-19-13(17)14(2)7-10-8(11(15)18-3)6-9(14)12(16)20-10/h4,6,9-10H,1,5,7H2,2-3H3/t9-,10+,14-/m1/s1 |
| InChIKey | TWBQSNHHMCPUAN-ISTVAULSSA-N |
| XLogP | 0.77 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|