C22H27NO6 — CID 23260513
diethyl 5-methoxy-3',4'-dimethyl-3-oxospiro[1H-indole-2,6'-cyclohex-3-ene]-1',1'-dicarboxylate (PubChem CID 23260513) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is diethyl 5-methoxy-3',4'-dimethyl-3-oxospiro[1H-indole-2,6'-cyclohex-3-ene]-1',1'-dicarboxylate.
| Compound Name | diethyl 5-methoxy-3',4'-dimethyl-3-oxospiro[1H-indole-2,6'-cyclohex-3-ene]-1',1'-dicarboxylate |
|---|---|
| PubChem CID | 23260513 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | diethyl 5-methoxy-3',4'-dimethyl-3-oxospiro[1H-indole-2,6'-cyclohex-3-ene]-1',1'-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(C)=C(C)CC12Nc1ccc(OC)cc1C2=O |
| InChI | InChI=1S/C22H27NO6/c1-6-28-19(25)21(20(26)29-7-2)11-13(3)14(4)12-22(21)18(24)16-10-15(27-5)8-9-17(16)23-22/h8-10,23H,6-7,11-12H2,1-5H3 |
| InChIKey | LIVNBEDHGJFUNL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|