C15H12Cl2O6 — CID 23260534
(4R,4aR,9aR)-4a,7-dichloro-5,8-dihydroxy-4-methoxy-1,3,4,9a-tetrahydroanthracene-2,9,10-trione (PubChem CID 23260534) has the molecular formula C15H12Cl2O6 and a molecular weight of 359.16 g/mol. Its IUPAC name is (4R,4aR,9aR)-4a,7-dichloro-5,8-dihydroxy-4-methoxy-1,3,4,9a-tetrahydroanthracene-2,9,10-trione.
| Compound Name | (4R,4aR,9aR)-4a,7-dichloro-5,8-dihydroxy-4-methoxy-1,3,4,9a-tetrahydroanthracene-2,9,10-trione |
|---|---|
| PubChem CID | 23260534 |
| Molecular Formula | C15H12Cl2O6 |
| Molecular Weight | 359.16 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | (4R,4aR,9aR)-4a,7-dichloro-5,8-dihydroxy-4-methoxy-1,3,4,9a-tetrahydroanthracene-2,9,10-trione |
| SMILES | CO[C@@H]1CC(=O)C[C@@H]2C(=O)c3c(O)c(Cl)cc(O)c3C(=O)[C@@]21Cl |
| InChI | InChI=1S/C15H12Cl2O6/c1-23-9-3-5(18)2-6-12(20)11-10(14(22)15(6,9)17)8(19)4-7(16)13(11)21/h4,6,9,19,21H,2-3H2,1H3/t6-,9-,15-/m1/s1 |
| InChIKey | NUJTXWDIMIKBBT-VCESJLBLSA-N |
| XLogP | 2.10 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.16 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|