C18H28O4Si — CID 23260559
(5R,7S)-5-[tert-butyl(dimethyl)silyl]oxy-7-(1-hydroxyethyl)-5,6,7,8-tetrahydronaphthalene-1,4-dione (PubChem CID 23260559) has the molecular formula C18H28O4Si and a molecular weight of 336.50 g/mol. Its IUPAC name is (5R,7S)-5-[tert-butyl(dimethyl)silyl]oxy-7-(1-hydroxyethyl)-5,6,7,8-tetrahydronaphthalene-1,4-dione.
| Compound Name | (5R,7S)-5-[tert-butyl(dimethyl)silyl]oxy-7-(1-hydroxyethyl)-5,6,7,8-tetrahydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 23260559 |
| Molecular Formula | C18H28O4Si |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (5R,7S)-5-[tert-butyl(dimethyl)silyl]oxy-7-(1-hydroxyethyl)-5,6,7,8-tetrahydronaphthalene-1,4-dione |
| SMILES | CC(O)[C@H]1CC2=C(C(=O)C=CC2=O)[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C18H28O4Si/c1-11(19)12-9-13-14(20)7-8-15(21)17(13)16(10-12)22-23(5,6)18(2,3)4/h7-8,11-12,16,19H,9-10H2,1-6H3/t11?,12-,16+/m0/s1 |
| InChIKey | UDCPBKQODHZSDS-OZGRPGILSA-N |
| XLogP | 3.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|