C20H34O5Si — CID 23260561
(6S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-6-(1-hydroxyethyl)-4,4-dimethoxy-5,6,7,8-tetrahydronaphthalen-1-one (PubChem CID 23260561) has the molecular formula C20H34O5Si and a molecular weight of 382.57 g/mol. Its IUPAC name is (6S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-6-(1-hydroxyethyl)-4,4-dimethoxy-5,6,7,8-tetrahydronaphthalen-1-one.
| Compound Name | (6S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-6-(1-hydroxyethyl)-4,4-dimethoxy-5,6,7,8-tetrahydronaphthalen-1-one |
|---|---|
| PubChem CID | 23260561 |
| Molecular Formula | C20H34O5Si |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | (6S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-6-(1-hydroxyethyl)-4,4-dimethoxy-5,6,7,8-tetrahydronaphthalen-1-one |
| SMILES | COC1(OC)C=CC(=O)C2=C1C[C@H](C(C)O)C[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O5Si/c1-13(21)14-11-15-18(16(22)9-10-20(15,23-5)24-6)17(12-14)25-26(7,8)19(2,3)4/h9-10,13-14,17,21H,11-12H2,1-8H3/t13?,14-,17+/m0/s1 |
| InChIKey | AZNRWDRBECRHKZ-XLGXCUCASA-N |
| XLogP | 3.59 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|