C30H25BO8 — CID 23260601
[(1S,17S)-3-acetyloxy-17-ethyl-5,12-dioxo-19-phenyl-18,20-dioxa-19-borapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6,8,10,13-hexaen-14-yl] acetate (PubChem CID 23260601) has the molecular formula C30H25BO8 and a molecular weight of 524.33 g/mol. Its IUPAC name is [(1S,17S)-3-acetyloxy-17-ethyl-5,12-dioxo-19-phenyl-18,20-dioxa-19-borapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6,8,10,13-hexaen-14-yl] acetate.
| Compound Name | [(1S,17S)-3-acetyloxy-17-ethyl-5,12-dioxo-19-phenyl-18,20-dioxa-19-borapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6,8,10,13-hexaen-14-yl] acetate |
|---|---|
| PubChem CID | 23260601 |
| Molecular Formula | C30H25BO8 |
| Molecular Weight | 524.33 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | [(1S,17S)-3-acetyloxy-17-ethyl-5,12-dioxo-19-phenyl-18,20-dioxa-19-borapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6,8,10,13-hexaen-14-yl] acetate |
| SMILES | CC[C@]12Cc3c(OC(C)=O)c4c(c(OC(C)=O)c3[C@H](C1)OB(c1ccccc1)O2)C(=O)c1ccccc1C4=O |
| InChI | InChI=1S/C30H25BO8/c1-4-30-14-21-23(22(15-30)38-31(39-30)18-10-6-5-7-11-18)29(37-17(3)33)25-24(28(21)36-16(2)32)26(34)19-12-8-9-13-20(19)27(25)35/h5-13,22H,4,14-15H2,1-3H3/t22-,30-/m0/s1 |
| InChIKey | LFKGFNOKHRWXBT-CHJDUVSTSA-N |
| XLogP | 3.89 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|