C28H23BO8 — CID 23260632
[(1S)-1-[(1S,17S)-3,14-dihydroxy-5,12-dioxo-19-phenyl-18,20-dioxa-19-borapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6,8,10,13-hexaen-17-yl]ethyl] acetate (PubChem CID 23260632) has the molecular formula C28H23BO8 and a molecular weight of 498.30 g/mol. Its IUPAC name is [(1S)-1-[(1S,17S)-3,14-dihydroxy-5,12-dioxo-19-phenyl-18,20-dioxa-19-borapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6,8,10,13-hexaen-17-yl]ethyl] acetate.
| Compound Name | [(1S)-1-[(1S,17S)-3,14-dihydroxy-5,12-dioxo-19-phenyl-18,20-dioxa-19-borapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6,8,10,13-hexaen-17-yl]ethyl] acetate |
|---|---|
| PubChem CID | 23260632 |
| Molecular Formula | C28H23BO8 |
| Molecular Weight | 498.30 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | [(1S)-1-[(1S,17S)-3,14-dihydroxy-5,12-dioxo-19-phenyl-18,20-dioxa-19-borapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6,8,10,13-hexaen-17-yl]ethyl] acetate |
| SMILES | CC(=O)O[C@@H](C)[C@]12Cc3c(O)c4c(c(O)c3[C@H](C1)OB(c1ccccc1)O2)C(=O)c1ccccc1C4=O |
| InChI | InChI=1S/C28H23BO8/c1-14(35-15(2)30)28-12-19-21(20(13-28)36-29(37-28)16-8-4-3-5-9-16)27(34)23-22(26(19)33)24(31)17-10-6-7-11-18(17)25(23)32/h3-11,14,20,33-34H,12-13H2,1-2H3/t14-,20-,28-/m0/s1 |
| InChIKey | ZDGUDIXVXWZLDM-CFMXGFMOSA-N |
| XLogP | 2.99 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|