C21H20O4S — CID 23260697
8-acetyl-6,11-dimethoxy-7,8,9,10-tetrahydrobenzo[b]thioxanthen-12-one (PubChem CID 23260697) has the molecular formula C21H20O4S and a molecular weight of 368.45 g/mol. Its IUPAC name is 8-acetyl-6,11-dimethoxy-7,8,9,10-tetrahydrobenzo[b]thioxanthen-12-one.
| Compound Name | 8-acetyl-6,11-dimethoxy-7,8,9,10-tetrahydrobenzo[b]thioxanthen-12-one |
|---|---|
| PubChem CID | 23260697 |
| Molecular Formula | C21H20O4S |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 8-acetyl-6,11-dimethoxy-7,8,9,10-tetrahydrobenzo[b]thioxanthen-12-one |
| SMILES | COc1c2c(c(OC)c3c(=O)c4ccccc4sc13)CCC(C(C)=O)C2 |
| InChI | InChI=1S/C21H20O4S/c1-11(22)12-8-9-13-15(10-12)20(25-3)21-17(19(13)24-2)18(23)14-6-4-5-7-16(14)26-21/h4-7,12H,8-10H2,1-3H3 |
| InChIKey | IQEXRBCSGFYZDU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|