About (NZ)-N-(2,2,2-trichloroethylidene)benzenesulfonamide
(NZ)-N-(2,2,2-trichloroethylidene)benzenesulfonamide (PubChem CID 23260965) has the molecular formula C8H6Cl3NO2S
and a molecular weight of 286.57 g/mol. Its IUPAC name is (NZ)-N-(2,2,2-trichloroethylidene)benzenesulfonamide.
Molecular Properties
| Compound Name | (NZ)-N-(2,2,2-trichloroethylidene)benzenesulfonamide |
| PubChem CID | 23260965 |
| Molecular Formula | C8H6Cl3NO2S |
| Molecular Weight | 286.57 g/mol |
| Exact Mass | 284.92 |
| IUPAC Name | (NZ)-N-(2,2,2-trichloroethylidene)benzenesulfonamide |
| SMILES | O=S(=O)(/N=C\C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C8H6Cl3NO2S/c9-8(10,11)6-12-15(13,14)7-4-2-1-3-5-7/h1-6H/b12-6- |
| InChIKey | JHXMVQKJYPRCEE-SDQBBNPISA-N |
| XLogP | 2.82 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-(2,2,2-trichloroethylidene)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-(2,2,2-trichloroethylidene)benzenesulfonamide?
The IUPAC name of (NZ)-N-(2,2,2-trichloroethylidene)benzenesulfonamide (CID 23260965) is (NZ)-N-(2,2,2-trichloroethylidene)benzenesulfonamide.
What is the SMILES notation for (NZ)-N-(2,2,2-trichloroethylidene)benzenesulfonamide?
The canonical SMILES for (NZ)-N-(2,2,2-trichloroethylidene)benzenesulfonamide is O=S(=O)(/N=C\C(Cl)(Cl)Cl)c1ccccc1.
What is the InChIKey of (NZ)-N-(2,2,2-trichloroethylidene)benzenesulfonamide?
The InChIKey is JHXMVQKJYPRCEE-SDQBBNPISA-N. The full InChI is InChI=1S/C8H6Cl3NO2S/c9-8(10,11)6-12-15(13,14)7-4-2-1-3-5-7/h1-6H/b12-6-.
What are the key properties of (NZ)-N-(2,2,2-trichloroethylidene)benzenesulfonamide?
(NZ)-N-(2,2,2-trichloroethylidene)benzenesulfonamide has a molecular weight of 286.57 g/mol, XLogP of 2.82, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-(2,2,2-trichloroethylidene)benzenesulfonamide is sourced from PubChem (CID 23260965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).