About (Z)-5,5-diethoxy-2,3-dimethylpent-2-enal
(Z)-5,5-diethoxy-2,3-dimethylpent-2-enal (PubChem CID 23261204) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is (Z)-5,5-diethoxy-2,3-dimethylpent-2-enal.
Molecular Properties
| Compound Name | (Z)-5,5-diethoxy-2,3-dimethylpent-2-enal |
| PubChem CID | 23261204 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (Z)-5,5-diethoxy-2,3-dimethylpent-2-enal |
| SMILES | CCOC(C/C(C)=C(/C)C=O)OCC |
| InChI | InChI=1S/C11H20O3/c1-5-13-11(14-6-2)7-9(3)10(4)8-12/h8,11H,5-7H2,1-4H3/b10-9- |
| InChIKey | ILQZMVPKLWQRQI-KTKRTIGZSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5,5-diethoxy-2,3-dimethylpent-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5,5-diethoxy-2,3-dimethylpent-2-enal?
The IUPAC name of (Z)-5,5-diethoxy-2,3-dimethylpent-2-enal (CID 23261204) is (Z)-5,5-diethoxy-2,3-dimethylpent-2-enal.
What is the SMILES notation for (Z)-5,5-diethoxy-2,3-dimethylpent-2-enal?
The canonical SMILES for (Z)-5,5-diethoxy-2,3-dimethylpent-2-enal is CCOC(C/C(C)=C(/C)C=O)OCC.
What is the InChIKey of (Z)-5,5-diethoxy-2,3-dimethylpent-2-enal?
The InChIKey is ILQZMVPKLWQRQI-KTKRTIGZSA-N. The full InChI is InChI=1S/C11H20O3/c1-5-13-11(14-6-2)7-9(3)10(4)8-12/h8,11H,5-7H2,1-4H3/b10-9-.
What are the key properties of (Z)-5,5-diethoxy-2,3-dimethylpent-2-enal?
(Z)-5,5-diethoxy-2,3-dimethylpent-2-enal has a molecular weight of 200.28 g/mol, XLogP of 2.31, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5,5-diethoxy-2,3-dimethylpent-2-enal is sourced from PubChem (CID 23261204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).