C4H2F6O4S — CID 23261239
(3S,4R)-2,2,3,5,5-pentafluoro-4-fluorosulfonyloxyoxolane (PubChem CID 23261239) has the molecular formula C4H2F6O4S and a molecular weight of 260.11 g/mol. Its IUPAC name is (3S,4R)-2,2,3,5,5-pentafluoro-4-fluorosulfonyloxyoxolane.
| Compound Name | (3S,4R)-2,2,3,5,5-pentafluoro-4-fluorosulfonyloxyoxolane |
|---|---|
| PubChem CID | 23261239 |
| Molecular Formula | C4H2F6O4S |
| Molecular Weight | 260.11 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | (3S,4R)-2,2,3,5,5-pentafluoro-4-fluorosulfonyloxyoxolane |
| SMILES | O=S(=O)(F)O[C@@H]1[C@H](F)C(F)(F)OC1(F)F |
| InChI | InChI=1S/C4H2F6O4S/c5-1-2(13-15(10,11)12)4(8,9)14-3(1,6)7/h1-2H/t1-,2+/m0/s1 |
| InChIKey | ADFOKADCSHVMNY-NHYDCYSISA-N |
| XLogP | 1.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.11 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |