C12H13F4NO — CID 2326126
4-[ethyl(2,2,3,3-tetrafluoropropyl)amino]benzaldehyde (PubChem CID 2326126) has the molecular formula C12H13F4NO and a molecular weight of 263.23 g/mol. Its IUPAC name is 4-[ethyl(2,2,3,3-tetrafluoropropyl)amino]benzaldehyde.
| Compound Name | 4-[ethyl(2,2,3,3-tetrafluoropropyl)amino]benzaldehyde |
|---|---|
| PubChem CID | 2326126 |
| Molecular Formula | C12H13F4NO |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 4-[ethyl(2,2,3,3-tetrafluoropropyl)amino]benzaldehyde |
| SMILES | CCN(CC(F)(F)C(F)F)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C12H13F4NO/c1-2-17(8-12(15,16)11(13)14)10-5-3-9(7-18)4-6-10/h3-7,11H,2,8H2,1H3 |
| InChIKey | VLCWOBVBVRZXLJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|