C9H19N2O+ — CID 23261376
N,N-diethyl-3,5-dimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-amine (PubChem CID 23261376) has the molecular formula C9H19N2O+ and a molecular weight of 171.26 g/mol. Its IUPAC name is N,N-diethyl-3,5-dimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-amine.
| Compound Name | N,N-diethyl-3,5-dimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-amine |
|---|---|
| PubChem CID | 23261376 |
| Molecular Formula | C9H19N2O+ |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.15 |
| IUPAC Name | N,N-diethyl-3,5-dimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-amine |
| SMILES | CCN(CC)C1=[N+](C)CC(C)O1 |
| InChI | InChI=1S/C9H19N2O/c1-5-11(6-2)9-10(4)7-8(3)12-9/h8H,5-7H2,1-4H3/q+1 |
| InChIKey | CDSPAUDWKFHBCZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|