3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid

C6H9NO3S — CID 23261616

IUPAC3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid
SMILESCC1SCN(C=O)C1C(=O)O
InChIInChI=1S/C6H9NO3S/c1-4-5(6(9)10)7(2-8)3-11-4/h2,4-5H,3H2,1H3,(H,9,10)
InChIKeyHQYNHAXMHOPOAG-UHFFFAOYSA-N
MW175.21 g/mol
LogP-0.01
Rot. Bonds2

About 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid

3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 23261616) has the molecular formula C6H9NO3S and a molecular weight of 175.21 g/mol. Its IUPAC name is 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid.

Molecular Properties

Compound Name3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid
PubChem CID23261616
Molecular FormulaC6H9NO3S
Molecular Weight175.21 g/mol
Exact Mass175.03
IUPAC Name3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid
SMILESCC1SCN(C=O)C1C(=O)O
InChIInChI=1S/C6H9NO3S/c1-4-5(6(9)10)7(2-8)3-11-4/h2,4-5H,3H2,1H3,(H,9,10)
InChIKeyHQYNHAXMHOPOAG-UHFFFAOYSA-N
XLogP-0.01
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.21
LogP ≤ 5-0.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid (CID 23261616) is 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid is CC1SCN(C=O)C1C(=O)O.
What is the InChIKey of 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is HQYNHAXMHOPOAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3S/c1-4-5(6(9)10)7(2-8)3-11-4/h2,4-5H,3H2,1H3,(H,9,10).
What are the key properties of 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid?
3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 175.21 g/mol, XLogP of -0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 23261616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).