About 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid
3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 23261616) has the molecular formula C6H9NO3S
and a molecular weight of 175.21 g/mol. Its IUPAC name is 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 23261616 |
| Molecular Formula | C6H9NO3S |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC1SCN(C=O)C1C(=O)O |
| InChI | InChI=1S/C6H9NO3S/c1-4-5(6(9)10)7(2-8)3-11-4/h2,4-5H,3H2,1H3,(H,9,10) |
| InChIKey | HQYNHAXMHOPOAG-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid (CID 23261616) is 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid is CC1SCN(C=O)C1C(=O)O.
What is the InChIKey of 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is HQYNHAXMHOPOAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3S/c1-4-5(6(9)10)7(2-8)3-11-4/h2,4-5H,3H2,1H3,(H,9,10).
What are the key properties of 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid?
3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 175.21 g/mol, XLogP of -0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-formyl-5-methyl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 23261616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).