About 5,6-dimethylpyrrolo[2,1-b][1,3]thiazole
5,6-dimethylpyrrolo[2,1-b][1,3]thiazole (PubChem CID 23261623) has the molecular formula C8H9NS
and a molecular weight of 151.23 g/mol. Its IUPAC name is 5,6-dimethylpyrrolo[2,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | 5,6-dimethylpyrrolo[2,1-b][1,3]thiazole |
| PubChem CID | 23261623 |
| Molecular Formula | C8H9NS |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | 5,6-dimethylpyrrolo[2,1-b][1,3]thiazole |
| SMILES | Cc1cc2sccn2c1C |
| InChI | InChI=1S/C8H9NS/c1-6-5-8-9(7(6)2)3-4-10-8/h3-5H,1-2H3 |
| InChIKey | DKMFGIBNBYNETD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dimethylpyrrolo[2,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethylpyrrolo[2,1-b][1,3]thiazole?
The IUPAC name of 5,6-dimethylpyrrolo[2,1-b][1,3]thiazole (CID 23261623) is 5,6-dimethylpyrrolo[2,1-b][1,3]thiazole.
What is the SMILES notation for 5,6-dimethylpyrrolo[2,1-b][1,3]thiazole?
The canonical SMILES for 5,6-dimethylpyrrolo[2,1-b][1,3]thiazole is Cc1cc2sccn2c1C.
What is the InChIKey of 5,6-dimethylpyrrolo[2,1-b][1,3]thiazole?
The InChIKey is DKMFGIBNBYNETD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NS/c1-6-5-8-9(7(6)2)3-4-10-8/h3-5H,1-2H3.
What are the key properties of 5,6-dimethylpyrrolo[2,1-b][1,3]thiazole?
5,6-dimethylpyrrolo[2,1-b][1,3]thiazole has a molecular weight of 151.23 g/mol, XLogP of 2.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethylpyrrolo[2,1-b][1,3]thiazole is sourced from PubChem (CID 23261623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).