About 2-[(E)-2-chloro-1-fluoroethenyl]-1,4-dioxane
2-[(E)-2-chloro-1-fluoroethenyl]-1,4-dioxane (PubChem CID 23261801) has the molecular formula C6H8ClFO2
and a molecular weight of 166.58 g/mol. Its IUPAC name is 2-[(E)-2-chloro-1-fluoroethenyl]-1,4-dioxane.
Molecular Properties
| Compound Name | 2-[(E)-2-chloro-1-fluoroethenyl]-1,4-dioxane |
| PubChem CID | 23261801 |
| Molecular Formula | C6H8ClFO2 |
| Molecular Weight | 166.58 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | 2-[(E)-2-chloro-1-fluoroethenyl]-1,4-dioxane |
| SMILES | F/C(=C/Cl)C1COCCO1 |
| InChI | InChI=1S/C6H8ClFO2/c7-3-5(8)6-4-9-1-2-10-6/h3,6H,1-2,4H2/b5-3+ |
| InChIKey | OWMPBYFHMNVFQX-HWKANZROSA-N |
| XLogP | 1.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.58 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(E)-2-chloro-1-fluoroethenyl]-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-chloro-1-fluoroethenyl]-1,4-dioxane?
The IUPAC name of 2-[(E)-2-chloro-1-fluoroethenyl]-1,4-dioxane (CID 23261801) is 2-[(E)-2-chloro-1-fluoroethenyl]-1,4-dioxane.
What is the SMILES notation for 2-[(E)-2-chloro-1-fluoroethenyl]-1,4-dioxane?
The canonical SMILES for 2-[(E)-2-chloro-1-fluoroethenyl]-1,4-dioxane is F/C(=C/Cl)C1COCCO1.
What is the InChIKey of 2-[(E)-2-chloro-1-fluoroethenyl]-1,4-dioxane?
The InChIKey is OWMPBYFHMNVFQX-HWKANZROSA-N. The full InChI is InChI=1S/C6H8ClFO2/c7-3-5(8)6-4-9-1-2-10-6/h3,6H,1-2,4H2/b5-3+.
What are the key properties of 2-[(E)-2-chloro-1-fluoroethenyl]-1,4-dioxane?
2-[(E)-2-chloro-1-fluoroethenyl]-1,4-dioxane has a molecular weight of 166.58 g/mol, XLogP of 1.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-chloro-1-fluoroethenyl]-1,4-dioxane is sourced from PubChem (CID 23261801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).