C16H19FO6 — CID 23261842
[(4aR,6R,7S,8S,8aR)-8-fluoro-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate (PubChem CID 23261842) has the molecular formula C16H19FO6 and a molecular weight of 326.32 g/mol. Its IUPAC name is [(4aR,6R,7S,8S,8aR)-8-fluoro-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate.
| Compound Name | [(4aR,6R,7S,8S,8aR)-8-fluoro-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate |
|---|---|
| PubChem CID | 23261842 |
| Molecular Formula | C16H19FO6 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | [(4aR,6R,7S,8S,8aR)-8-fluoro-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate |
| SMILES | CO[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](F)[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H19FO6/c1-9(18)21-14-12(17)13-11(22-16(14)19-2)8-20-15(23-13)10-6-4-3-5-7-10/h3-7,11-16H,8H2,1-2H3/t11-,12+,13-,14-,15?,16-/m1/s1 |
| InChIKey | XPJSQLYOOBOBOL-WYESOLTNSA-N |
| XLogP | 1.74 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |