C24H20O3 — CID 23262025
(2S,3R)-3-ethoxy-2-phenyl-2,3-dihydronaphtho[2,3-g][1,4]benzodioxine (PubChem CID 23262025) has the molecular formula C24H20O3 and a molecular weight of 356.42 g/mol. Its IUPAC name is (2S,3R)-3-ethoxy-2-phenyl-2,3-dihydronaphtho[2,3-g][1,4]benzodioxine.
| Compound Name | (2S,3R)-3-ethoxy-2-phenyl-2,3-dihydronaphtho[2,3-g][1,4]benzodioxine |
|---|---|
| PubChem CID | 23262025 |
| Molecular Formula | C24H20O3 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (2S,3R)-3-ethoxy-2-phenyl-2,3-dihydronaphtho[2,3-g][1,4]benzodioxine |
| SMILES | CCO[C@@H]1Oc2cc3cc4ccccc4cc3cc2O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H20O3/c1-2-25-24-23(16-8-4-3-5-9-16)26-21-14-19-12-17-10-6-7-11-18(17)13-20(19)15-22(21)27-24/h3-15,23-24H,2H2,1H3/t23-,24+/m0/s1 |
| InChIKey | NHVYBAYXQNCGEV-BJKOFHAPSA-N |
| XLogP | 5.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|