About (2S,6R)-2,4,6-trimethylmorpholine
(2S,6R)-2,4,6-trimethylmorpholine (PubChem CID 23262057) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is (2S,6R)-2,4,6-trimethylmorpholine.
Molecular Properties
| Compound Name | (2S,6R)-2,4,6-trimethylmorpholine |
| PubChem CID | 23262057 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | (2S,6R)-2,4,6-trimethylmorpholine |
| SMILES | C[C@@H]1CN(C)C[C@H](C)O1 |
| InChI | InChI=1S/C7H15NO/c1-6-4-8(3)5-7(2)9-6/h6-7H,4-5H2,1-3H3/t6-,7+ |
| InChIKey | APOJIILNJVLCQE-KNVOCYPGSA-N |
| XLogP | 0.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,6R)-2,4,6-trimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-2,4,6-trimethylmorpholine?
The IUPAC name of (2S,6R)-2,4,6-trimethylmorpholine (CID 23262057) is (2S,6R)-2,4,6-trimethylmorpholine.
What is the SMILES notation for (2S,6R)-2,4,6-trimethylmorpholine?
The canonical SMILES for (2S,6R)-2,4,6-trimethylmorpholine is C[C@@H]1CN(C)C[C@H](C)O1.
What is the InChIKey of (2S,6R)-2,4,6-trimethylmorpholine?
The InChIKey is APOJIILNJVLCQE-KNVOCYPGSA-N. The full InChI is InChI=1S/C7H15NO/c1-6-4-8(3)5-7(2)9-6/h6-7H,4-5H2,1-3H3/t6-,7+.
What are the key properties of (2S,6R)-2,4,6-trimethylmorpholine?
(2S,6R)-2,4,6-trimethylmorpholine has a molecular weight of 129.20 g/mol, XLogP of 0.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-2,4,6-trimethylmorpholine is sourced from PubChem (CID 23262057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).