About (2R,6R)-4-cyclohexyl-2,6-dimethylmorpholine
(2R,6R)-4-cyclohexyl-2,6-dimethylmorpholine (PubChem CID 23262067) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is (2R,6R)-4-cyclohexyl-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | (2R,6R)-4-cyclohexyl-2,6-dimethylmorpholine |
| PubChem CID | 23262067 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (2R,6R)-4-cyclohexyl-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(C2CCCCC2)C[C@@H](C)O1 |
| InChI | InChI=1S/C12H23NO/c1-10-8-13(9-11(2)14-10)12-6-4-3-5-7-12/h10-12H,3-9H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | VPLBSYNYQBEUGO-GHMZBOCLSA-N |
| XLogP | 2.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,6R)-4-cyclohexyl-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6R)-4-cyclohexyl-2,6-dimethylmorpholine?
The IUPAC name of (2R,6R)-4-cyclohexyl-2,6-dimethylmorpholine (CID 23262067) is (2R,6R)-4-cyclohexyl-2,6-dimethylmorpholine.
What is the SMILES notation for (2R,6R)-4-cyclohexyl-2,6-dimethylmorpholine?
The canonical SMILES for (2R,6R)-4-cyclohexyl-2,6-dimethylmorpholine is C[C@@H]1CN(C2CCCCC2)C[C@@H](C)O1.
What is the InChIKey of (2R,6R)-4-cyclohexyl-2,6-dimethylmorpholine?
The InChIKey is VPLBSYNYQBEUGO-GHMZBOCLSA-N. The full InChI is InChI=1S/C12H23NO/c1-10-8-13(9-11(2)14-10)12-6-4-3-5-7-12/h10-12H,3-9H2,1-2H3/t10-,11-/m1/s1.
What are the key properties of (2R,6R)-4-cyclohexyl-2,6-dimethylmorpholine?
(2R,6R)-4-cyclohexyl-2,6-dimethylmorpholine has a molecular weight of 197.32 g/mol, XLogP of 2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6R)-4-cyclohexyl-2,6-dimethylmorpholine is sourced from PubChem (CID 23262067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).