About [(2S,4S)-2-methyl-1,3-dioxolan-4-yl]methanol
[(2S,4S)-2-methyl-1,3-dioxolan-4-yl]methanol (PubChem CID 23262094) has the molecular formula C5H10O3
and a molecular weight of 118.13 g/mol. Its IUPAC name is [(2S,4S)-2-methyl-1,3-dioxolan-4-yl]methanol.
Molecular Properties
| Compound Name | [(2S,4S)-2-methyl-1,3-dioxolan-4-yl]methanol |
| PubChem CID | 23262094 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | [(2S,4S)-2-methyl-1,3-dioxolan-4-yl]methanol |
| SMILES | C[C@H]1OC[C@H](CO)O1 |
| InChI | InChI=1S/C5H10O3/c1-4-7-3-5(2-6)8-4/h4-6H,2-3H2,1H3/t4-,5-/m0/s1 |
| InChIKey | ZCYJBTKNPHKPPN-WHFBIAKZSA-N |
| XLogP | -0.26 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S,4S)-2-methyl-1,3-dioxolan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4S)-2-methyl-1,3-dioxolan-4-yl]methanol?
The IUPAC name of [(2S,4S)-2-methyl-1,3-dioxolan-4-yl]methanol (CID 23262094) is [(2S,4S)-2-methyl-1,3-dioxolan-4-yl]methanol.
What is the SMILES notation for [(2S,4S)-2-methyl-1,3-dioxolan-4-yl]methanol?
The canonical SMILES for [(2S,4S)-2-methyl-1,3-dioxolan-4-yl]methanol is C[C@H]1OC[C@H](CO)O1.
What is the InChIKey of [(2S,4S)-2-methyl-1,3-dioxolan-4-yl]methanol?
The InChIKey is ZCYJBTKNPHKPPN-WHFBIAKZSA-N. The full InChI is InChI=1S/C5H10O3/c1-4-7-3-5(2-6)8-4/h4-6H,2-3H2,1H3/t4-,5-/m0/s1.
What are the key properties of [(2S,4S)-2-methyl-1,3-dioxolan-4-yl]methanol?
[(2S,4S)-2-methyl-1,3-dioxolan-4-yl]methanol has a molecular weight of 118.13 g/mol, XLogP of -0.26, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4S)-2-methyl-1,3-dioxolan-4-yl]methanol is sourced from PubChem (CID 23262094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).