About 4-(chloromethyl)-2,2-bis(trifluoromethyl)-1,3-dioxolane
4-(chloromethyl)-2,2-bis(trifluoromethyl)-1,3-dioxolane (PubChem CID 23262107) has the molecular formula C6H5ClF6O2
and a molecular weight of 258.55 g/mol. Its IUPAC name is 4-(chloromethyl)-2,2-bis(trifluoromethyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | 4-(chloromethyl)-2,2-bis(trifluoromethyl)-1,3-dioxolane |
| PubChem CID | 23262107 |
| Molecular Formula | C6H5ClF6O2 |
| Molecular Weight | 258.55 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 4-(chloromethyl)-2,2-bis(trifluoromethyl)-1,3-dioxolane |
| SMILES | FC(F)(F)C1(C(F)(F)F)OCC(CCl)O1 |
| InChI | InChI=1S/C6H5ClF6O2/c7-1-3-2-14-4(15-3,5(8,9)10)6(11,12)13/h3H,1-2H2 |
| InChIKey | VCBXSBCCXPVZMG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.55 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-2,2-bis(trifluoromethyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-2,2-bis(trifluoromethyl)-1,3-dioxolane?
The IUPAC name of 4-(chloromethyl)-2,2-bis(trifluoromethyl)-1,3-dioxolane (CID 23262107) is 4-(chloromethyl)-2,2-bis(trifluoromethyl)-1,3-dioxolane.
What is the SMILES notation for 4-(chloromethyl)-2,2-bis(trifluoromethyl)-1,3-dioxolane?
The canonical SMILES for 4-(chloromethyl)-2,2-bis(trifluoromethyl)-1,3-dioxolane is FC(F)(F)C1(C(F)(F)F)OCC(CCl)O1.
What is the InChIKey of 4-(chloromethyl)-2,2-bis(trifluoromethyl)-1,3-dioxolane?
The InChIKey is VCBXSBCCXPVZMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClF6O2/c7-1-3-2-14-4(15-3,5(8,9)10)6(11,12)13/h3H,1-2H2.
What are the key properties of 4-(chloromethyl)-2,2-bis(trifluoromethyl)-1,3-dioxolane?
4-(chloromethyl)-2,2-bis(trifluoromethyl)-1,3-dioxolane has a molecular weight of 258.55 g/mol, XLogP of 2.46, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-2,2-bis(trifluoromethyl)-1,3-dioxolane is sourced from PubChem (CID 23262107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).