About 2-methyl-2-(2-phenylethyl)-1,3-oxathiolane
2-methyl-2-(2-phenylethyl)-1,3-oxathiolane (PubChem CID 23262133) has the molecular formula C12H16OS
and a molecular weight of 208.33 g/mol. Its IUPAC name is 2-methyl-2-(2-phenylethyl)-1,3-oxathiolane.
Molecular Properties
| Compound Name | 2-methyl-2-(2-phenylethyl)-1,3-oxathiolane |
| PubChem CID | 23262133 |
| Molecular Formula | C12H16OS |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 2-methyl-2-(2-phenylethyl)-1,3-oxathiolane |
| SMILES | CC1(CCc2ccccc2)OCCS1 |
| InChI | InChI=1S/C12H16OS/c1-12(13-9-10-14-12)8-7-11-5-3-2-4-6-11/h2-6H,7-10H2,1H3 |
| InChIKey | MPSLMEBPJNUGKF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-2-(2-phenylethyl)-1,3-oxathiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-(2-phenylethyl)-1,3-oxathiolane?
The IUPAC name of 2-methyl-2-(2-phenylethyl)-1,3-oxathiolane (CID 23262133) is 2-methyl-2-(2-phenylethyl)-1,3-oxathiolane.
What is the SMILES notation for 2-methyl-2-(2-phenylethyl)-1,3-oxathiolane?
The canonical SMILES for 2-methyl-2-(2-phenylethyl)-1,3-oxathiolane is CC1(CCc2ccccc2)OCCS1.
What is the InChIKey of 2-methyl-2-(2-phenylethyl)-1,3-oxathiolane?
The InChIKey is MPSLMEBPJNUGKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16OS/c1-12(13-9-10-14-12)8-7-11-5-3-2-4-6-11/h2-6H,7-10H2,1H3.
What are the key properties of 2-methyl-2-(2-phenylethyl)-1,3-oxathiolane?
2-methyl-2-(2-phenylethyl)-1,3-oxathiolane has a molecular weight of 208.33 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(2-phenylethyl)-1,3-oxathiolane is sourced from PubChem (CID 23262133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).