C17H21N2OPS — CID 23262175
(4R,5S)-N,N,3-trimethyl-4,5-diphenyl-2-sulfanylidene-1,3,2λ5-oxazaphospholidin-2-amine (PubChem CID 23262175) has the molecular formula C17H21N2OPS and a molecular weight of 332.41 g/mol. Its IUPAC name is (4R,5S)-N,N,3-trimethyl-4,5-diphenyl-2-sulfanylidene-1,3,2λ5-oxazaphospholidin-2-amine.
| Compound Name | (4R,5S)-N,N,3-trimethyl-4,5-diphenyl-2-sulfanylidene-1,3,2λ5-oxazaphospholidin-2-amine |
|---|---|
| PubChem CID | 23262175 |
| Molecular Formula | C17H21N2OPS |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | (4R,5S)-N,N,3-trimethyl-4,5-diphenyl-2-sulfanylidene-1,3,2λ5-oxazaphospholidin-2-amine |
| SMILES | CN(C)P1(=S)O[C@@H](c2ccccc2)[C@@H](c2ccccc2)N1C |
| InChI | InChI=1S/C17H21N2OPS/c1-18(2)21(22)19(3)16(14-10-6-4-7-11-14)17(20-21)15-12-8-5-9-13-15/h4-13,16-17H,1-3H3/t16-,17+,21?/m1/s1 |
| InChIKey | FAZRMIHOUHIQOR-LXMSXWCSSA-N |
| XLogP | 4.22 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|