C10H10Cl5O2PS2 — CID 23262179
diethoxy-(2,3,4,5,6-pentachlorophenyl)sulfanyl-sulfanylidene-λ5-phosphane (PubChem CID 23262179) has the molecular formula C10H10Cl5O2PS2 and a molecular weight of 434.56 g/mol. Its IUPAC name is diethoxy-(2,3,4,5,6-pentachlorophenyl)sulfanyl-sulfanylidene-λ5-phosphane.
| Compound Name | diethoxy-(2,3,4,5,6-pentachlorophenyl)sulfanyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 23262179 |
| Molecular Formula | C10H10Cl5O2PS2 |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 431.83 |
| IUPAC Name | diethoxy-(2,3,4,5,6-pentachlorophenyl)sulfanyl-sulfanylidene-λ5-phosphane |
| SMILES | CCOP(=S)(OCC)Sc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C10H10Cl5O2PS2/c1-3-16-18(19,17-4-2)20-10-8(14)6(12)5(11)7(13)9(10)15/h3-4H2,1-2H3 |
| InChIKey | ZFKUUYKDRXOOMJ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|