About 2-methylsulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane
2-methylsulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane (PubChem CID 23262274) has the molecular formula C4H9O2PS2
and a molecular weight of 184.22 g/mol. Its IUPAC name is 2-methylsulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane.
Molecular Properties
| Compound Name | 2-methylsulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane |
| PubChem CID | 23262274 |
| Molecular Formula | C4H9O2PS2 |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 183.98 |
| IUPAC Name | 2-methylsulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane |
| SMILES | CSP1(=S)OCCCO1 |
| InChI | InChI=1S/C4H9O2PS2/c1-9-7(8)5-3-2-4-6-7/h2-4H2,1H3 |
| InChIKey | SSQMIJXEDHFRFB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane?
The IUPAC name of 2-methylsulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane (CID 23262274) is 2-methylsulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane.
What is the SMILES notation for 2-methylsulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane?
The canonical SMILES for 2-methylsulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane is CSP1(=S)OCCCO1.
What is the InChIKey of 2-methylsulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane?
The InChIKey is SSQMIJXEDHFRFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O2PS2/c1-9-7(8)5-3-2-4-6-7/h2-4H2,1H3.
What are the key properties of 2-methylsulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane?
2-methylsulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane has a molecular weight of 184.22 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane is sourced from PubChem (CID 23262274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).