C6H12O2S — CID 23262324
2,4,6-trimethyl-1,3,5-dioxathiane (PubChem CID 23262324) has the molecular formula C6H12O2S and a molecular weight of 148.23 g/mol. Its IUPAC name is 2,4,6-trimethyl-1,3,5-dioxathiane.
| Compound Name | 2,4,6-trimethyl-1,3,5-dioxathiane |
|---|---|
| PubChem CID | 23262324 |
| Molecular Formula | C6H12O2S |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 2,4,6-trimethyl-1,3,5-dioxathiane |
| SMILES | CC1OC(C)SC(C)O1 |
| InChI | InChI=1S/C6H12O2S/c1-4-7-5(2)9-6(3)8-4/h4-6H,1-3H3 |
| InChIKey | WUHFWXZFUPGXHX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |