C9H6F12S — CID 23262448
3-ethylsulfanyl-1,1,1,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pent-2-ene (PubChem CID 23262448) has the molecular formula C9H6F12S and a molecular weight of 374.19 g/mol. Its IUPAC name is 3-ethylsulfanyl-1,1,1,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pent-2-ene.
| Compound Name | 3-ethylsulfanyl-1,1,1,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 23262448 |
| Molecular Formula | C9H6F12S |
| Molecular Weight | 374.19 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | 3-ethylsulfanyl-1,1,1,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pent-2-ene |
| SMILES | CCSC(=C(C(F)(F)F)C(F)(F)F)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H6F12S/c1-2-22-3(4(6(10,11)12)7(13,14)15)5(8(16,17)18)9(19,20)21/h4H,2H2,1H3 |
| InChIKey | LTLSKUSTRVGVOH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.19 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |