C4HClF4 — CID 23262586
(3E)-4-chloro-1,1,2,3-tetrafluorobuta-1,3-diene (PubChem CID 23262586) has the molecular formula C4HClF4 and a molecular weight of 160.50 g/mol. Its IUPAC name is (3E)-4-chloro-1,1,2,3-tetrafluorobuta-1,3-diene.
| Compound Name | (3E)-4-chloro-1,1,2,3-tetrafluorobuta-1,3-diene |
|---|---|
| PubChem CID | 23262586 |
| Molecular Formula | C4HClF4 |
| Molecular Weight | 160.50 g/mol |
| Exact Mass | 159.97 |
| IUPAC Name | (3E)-4-chloro-1,1,2,3-tetrafluorobuta-1,3-diene |
| SMILES | FC(F)=C(F)/C(F)=C\Cl |
| InChI | InChI=1S/C4HClF4/c5-1-2(6)3(7)4(8)9/h1H/b2-1+ |
| InChIKey | CKKWIZMQPJGQOS-OWOJBTEDSA-N |
| XLogP | 3.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|