C12H16N2S — CID 23262634
5-tert-butyl-2-phenyl-2,3-dihydro-1,3,4-thiadiazole (PubChem CID 23262634) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 5-tert-butyl-2-phenyl-2,3-dihydro-1,3,4-thiadiazole.
| Compound Name | 5-tert-butyl-2-phenyl-2,3-dihydro-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 23262634 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 5-tert-butyl-2-phenyl-2,3-dihydro-1,3,4-thiadiazole |
| SMILES | CC(C)(C)C1=NNC(c2ccccc2)S1 |
| InChI | InChI=1S/C12H16N2S/c1-12(2,3)11-14-13-10(15-11)9-7-5-4-6-8-9/h4-8,10,13H,1-3H3 |
| InChIKey | ZYCZIRFYMGCKFT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |