C12H18OS — CID 23262639
(2R,4S,4aR,8aS)-4-ethynyl-2-methyl-2,3,4a,5,6,7,8,8a-octahydrothiochromen-4-ol (PubChem CID 23262639) has the molecular formula C12H18OS and a molecular weight of 210.34 g/mol. Its IUPAC name is (2R,4S,4aR,8aS)-4-ethynyl-2-methyl-2,3,4a,5,6,7,8,8a-octahydrothiochromen-4-ol.
| Compound Name | (2R,4S,4aR,8aS)-4-ethynyl-2-methyl-2,3,4a,5,6,7,8,8a-octahydrothiochromen-4-ol |
|---|---|
| PubChem CID | 23262639 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (2R,4S,4aR,8aS)-4-ethynyl-2-methyl-2,3,4a,5,6,7,8,8a-octahydrothiochromen-4-ol |
| SMILES | C#C[C@]1(O)C[C@@H](C)S[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C12H18OS/c1-3-12(13)8-9(2)14-11-7-5-4-6-10(11)12/h1,9-11,13H,4-8H2,2H3/t9-,10+,11+,12+/m1/s1 |
| InChIKey | HMMPBKORGPXTEU-RHYQMDGZSA-N |
| XLogP | 2.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|