C6H2F8O — CID 23262860
3,3,4,4,5,5,6,6-octafluorocyclohexen-1-ol (PubChem CID 23262860) has the molecular formula C6H2F8O and a molecular weight of 242.06 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6-octafluorocyclohexen-1-ol.
| Compound Name | 3,3,4,4,5,5,6,6-octafluorocyclohexen-1-ol |
|---|---|
| PubChem CID | 23262860 |
| Molecular Formula | C6H2F8O |
| Molecular Weight | 242.06 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | 3,3,4,4,5,5,6,6-octafluorocyclohexen-1-ol |
| SMILES | OC1=CC(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6H2F8O/c7-3(8)1-2(15)4(9,10)6(13,14)5(3,11)12/h1,15H |
| InChIKey | WRDCANXKHYBUBU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.06 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|