C7HF13 — CID 23262930
(Z)-1,1,1,2,2,3,5,6,6,6-decafluoro-5-(trifluoromethyl)hex-3-ene (PubChem CID 23262930) has the molecular formula C7HF13 and a molecular weight of 332.06 g/mol. Its IUPAC name is (Z)-1,1,1,2,2,3,5,6,6,6-decafluoro-5-(trifluoromethyl)hex-3-ene.
| Compound Name | (Z)-1,1,1,2,2,3,5,6,6,6-decafluoro-5-(trifluoromethyl)hex-3-ene |
|---|---|
| PubChem CID | 23262930 |
| Molecular Formula | C7HF13 |
| Molecular Weight | 332.06 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | (Z)-1,1,1,2,2,3,5,6,6,6-decafluoro-5-(trifluoromethyl)hex-3-ene |
| SMILES | F/C(=C\C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7HF13/c8-2(4(10,11)7(18,19)20)1-3(9,5(12,13)14)6(15,16)17/h1H/b2-1- |
| InChIKey | QXFFGEDJBKQKCL-UPHRSURJSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.06 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|