C14H14N2O7 — CID 23263103
6-nitro-1-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]indole-3-carbaldehyde (PubChem CID 23263103) has the molecular formula C14H14N2O7 and a molecular weight of 322.27 g/mol. Its IUPAC name is 6-nitro-1-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]indole-3-carbaldehyde.
| Compound Name | 6-nitro-1-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]indole-3-carbaldehyde |
|---|---|
| PubChem CID | 23263103 |
| Molecular Formula | C14H14N2O7 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 6-nitro-1-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]indole-3-carbaldehyde |
| SMILES | O=Cc1cn([C@@H]2OC[C@H](O)[C@H](O)[C@H]2O)c2cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C14H14N2O7/c17-5-7-4-15(14-13(20)12(19)11(18)6-23-14)10-3-8(16(21)22)1-2-9(7)10/h1-5,11-14,18-20H,6H2/t11-,12-,13+,14+/m0/s1 |
| InChIKey | BWKFIKGGJKTAII-IGQOVBAYSA-N |
| XLogP | -0.03 |
| TPSA | 135.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|