C9H5F5O — CID 23263422
1-(2,3,4,5,6-pentafluorophenyl)propan-1-one (PubChem CID 23263422) has the molecular formula C9H5F5O and a molecular weight of 224.13 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)propan-1-one.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 23263422 |
| Molecular Formula | C9H5F5O |
| Molecular Weight | 224.13 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)propan-1-one |
| SMILES | CCC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H5F5O/c1-2-3(15)4-5(10)7(12)9(14)8(13)6(4)11/h2H2,1H3 |
| InChIKey | FCWITTYOAQFQCE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.13 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|