C13H16O8 — CID 23263788
trimethyl 4,5-dimethoxycyclopenta-3,5-diene-1,2,3-tricarboxylate (PubChem CID 23263788) has the molecular formula C13H16O8 and a molecular weight of 300.26 g/mol. Its IUPAC name is trimethyl 4,5-dimethoxycyclopenta-3,5-diene-1,2,3-tricarboxylate.
| Compound Name | trimethyl 4,5-dimethoxycyclopenta-3,5-diene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 23263788 |
| Molecular Formula | C13H16O8 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | trimethyl 4,5-dimethoxycyclopenta-3,5-diene-1,2,3-tricarboxylate |
| SMILES | COC(=O)C1=C(OC)C(OC)=C(C(=O)OC)C1C(=O)OC |
| InChI | InChI=1S/C13H16O8/c1-17-9-7(12(15)20-4)6(11(14)19-3)8(10(9)18-2)13(16)21-5/h6H,1-5H3 |
| InChIKey | YZFGUENHKPYNPK-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|