C19H40S4 — CID 23263938
1-[1,3,3-tris(butylsulfanyl)propylsulfanyl]butane (PubChem CID 23263938) has the molecular formula C19H40S4 and a molecular weight of 396.80 g/mol. Its IUPAC name is 1-[1,3,3-tris(butylsulfanyl)propylsulfanyl]butane.
| Compound Name | 1-[1,3,3-tris(butylsulfanyl)propylsulfanyl]butane |
|---|---|
| PubChem CID | 23263938 |
| Molecular Formula | C19H40S4 |
| Molecular Weight | 396.80 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 1-[1,3,3-tris(butylsulfanyl)propylsulfanyl]butane |
| SMILES | CCCCSC(CC(SCCCC)SCCCC)SCCCC |
| InChI | InChI=1S/C19H40S4/c1-5-9-13-20-18(21-14-10-6-2)17-19(22-15-11-7-3)23-16-12-8-4/h18-19H,5-17H2,1-4H3 |
| InChIKey | YIKSBYZWSAJJEK-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.80 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|