C22H28O6 — CID 23263984
8-(4-hydroxy-3,5-dimethoxyphenyl)-1,3-dimethoxy-6,7-dimethyl-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 23263984) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is 8-(4-hydroxy-3,5-dimethoxyphenyl)-1,3-dimethoxy-6,7-dimethyl-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 8-(4-hydroxy-3,5-dimethoxyphenyl)-1,3-dimethoxy-6,7-dimethyl-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 23263984 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 8-(4-hydroxy-3,5-dimethoxyphenyl)-1,3-dimethoxy-6,7-dimethyl-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | COc1cc(C2c3c(cc(OC)c(O)c3OC)CC(C)C2C)cc(OC)c1O |
| InChI | InChI=1S/C22H28O6/c1-11-7-13-8-17(27-5)21(24)22(28-6)19(13)18(12(11)2)14-9-15(25-3)20(23)16(10-14)26-4/h8-12,18,23-24H,7H2,1-6H3 |
| InChIKey | OCLDVFIKFFYZJM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |