C15H27N3 — CID 23264140
2,4,6-trimethyl-1,3,5-tris(prop-2-enyl)-1,3,5-triazinane (PubChem CID 23264140) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 2,4,6-trimethyl-1,3,5-tris(prop-2-enyl)-1,3,5-triazinane.
| Compound Name | 2,4,6-trimethyl-1,3,5-tris(prop-2-enyl)-1,3,5-triazinane |
|---|---|
| PubChem CID | 23264140 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 2,4,6-trimethyl-1,3,5-tris(prop-2-enyl)-1,3,5-triazinane |
| SMILES | C=CCN1C(C)N(CC=C)C(C)N(CC=C)C1C |
| InChI | InChI=1S/C15H27N3/c1-7-10-16-13(4)17(11-8-2)15(6)18(12-9-3)14(16)5/h7-9,13-15H,1-3,10-12H2,4-6H3 |
| InChIKey | NVXVUZGXZGPYSW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|