C3H2Cl3F5Si — CID 23264214
trichloro(1,1,1,3,3-pentafluoropropan-2-yl)silane (PubChem CID 23264214) has the molecular formula C3H2Cl3F5Si and a molecular weight of 267.48 g/mol. Its IUPAC name is trichloro(1,1,1,3,3-pentafluoropropan-2-yl)silane.
| Compound Name | trichloro(1,1,1,3,3-pentafluoropropan-2-yl)silane |
|---|---|
| PubChem CID | 23264214 |
| Molecular Formula | C3H2Cl3F5Si |
| Molecular Weight | 267.48 g/mol |
| Exact Mass | 265.89 |
| IUPAC Name | trichloro(1,1,1,3,3-pentafluoropropan-2-yl)silane |
| SMILES | FC(F)C(C(F)(F)F)[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C3H2Cl3F5Si/c4-12(5,6)1(2(7)8)3(9,10)11/h1-2H |
| InChIKey | MQBQKYWXCNTIGF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|