About 1,4-dibromo-1-chlorobuta-1,2-diene
1,4-dibromo-1-chlorobuta-1,2-diene (PubChem CID 23264232) has the molecular formula C4H3Br2Cl
and a molecular weight of 246.33 g/mol. Its IUPAC name is 1,4-dibromo-1-chlorobuta-1,2-diene.
Molecular Properties
| Compound Name | 1,4-dibromo-1-chlorobuta-1,2-diene |
| PubChem CID | 23264232 |
| Molecular Formula | C4H3Br2Cl |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 243.83 |
| IUPAC Name | 1,4-dibromo-1-chlorobuta-1,2-diene |
| SMILES | ClC(Br)=C=CCBr |
| InChI | InChI=1S/C4H3Br2Cl/c5-3-1-2-4(6)7/h1H,3H2 |
| InChIKey | SKAIKXCQANTNDI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dibromo-1-chlorobuta-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dibromo-1-chlorobuta-1,2-diene?
The IUPAC name of 1,4-dibromo-1-chlorobuta-1,2-diene (CID 23264232) is 1,4-dibromo-1-chlorobuta-1,2-diene.
What is the SMILES notation for 1,4-dibromo-1-chlorobuta-1,2-diene?
The canonical SMILES for 1,4-dibromo-1-chlorobuta-1,2-diene is ClC(Br)=C=CCBr.
What is the InChIKey of 1,4-dibromo-1-chlorobuta-1,2-diene?
The InChIKey is SKAIKXCQANTNDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3Br2Cl/c5-3-1-2-4(6)7/h1H,3H2.
What are the key properties of 1,4-dibromo-1-chlorobuta-1,2-diene?
1,4-dibromo-1-chlorobuta-1,2-diene has a molecular weight of 246.33 g/mol, XLogP of 3.01, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dibromo-1-chlorobuta-1,2-diene is sourced from PubChem (CID 23264232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).