C4H4Cl2F6Si — CID 23264242
dichloro-(1,1,1,2,3,3-hexafluoropropan-2-yl)-methylsilane (PubChem CID 23264242) has the molecular formula C4H4Cl2F6Si and a molecular weight of 265.06 g/mol. Its IUPAC name is dichloro-(1,1,1,2,3,3-hexafluoropropan-2-yl)-methylsilane.
| Compound Name | dichloro-(1,1,1,2,3,3-hexafluoropropan-2-yl)-methylsilane |
|---|---|
| PubChem CID | 23264242 |
| Molecular Formula | C4H4Cl2F6Si |
| Molecular Weight | 265.06 g/mol |
| Exact Mass | 263.94 |
| IUPAC Name | dichloro-(1,1,1,2,3,3-hexafluoropropan-2-yl)-methylsilane |
| SMILES | C[Si](Cl)(Cl)C(F)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C4H4Cl2F6Si/c1-13(5,6)3(9,2(7)8)4(10,11)12/h2H,1H3 |
| InChIKey | IIDRYKQHFLXODB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.06 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|