C5H7ClF6Si — CID 23264278
chloro-(1,1,1,2,3,3-hexafluoropropan-2-yl)-dimethylsilane (PubChem CID 23264278) has the molecular formula C5H7ClF6Si and a molecular weight of 244.64 g/mol. Its IUPAC name is chloro-(1,1,1,2,3,3-hexafluoropropan-2-yl)-dimethylsilane.
| Compound Name | chloro-(1,1,1,2,3,3-hexafluoropropan-2-yl)-dimethylsilane |
|---|---|
| PubChem CID | 23264278 |
| Molecular Formula | C5H7ClF6Si |
| Molecular Weight | 244.64 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | chloro-(1,1,1,2,3,3-hexafluoropropan-2-yl)-dimethylsilane |
| SMILES | C[Si](C)(Cl)C(F)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H7ClF6Si/c1-13(2,6)4(9,3(7)8)5(10,11)12/h3H,1-2H3 |
| InChIKey | YLFGEAJLGATJAD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|