C5H8ClF5Si — CID 23264280
chloro-dimethyl-(1,1,1,3,3-pentafluoropropan-2-yl)silane (PubChem CID 23264280) has the molecular formula C5H8ClF5Si and a molecular weight of 226.65 g/mol. Its IUPAC name is chloro-dimethyl-(1,1,1,3,3-pentafluoropropan-2-yl)silane.
| Compound Name | chloro-dimethyl-(1,1,1,3,3-pentafluoropropan-2-yl)silane |
|---|---|
| PubChem CID | 23264280 |
| Molecular Formula | C5H8ClF5Si |
| Molecular Weight | 226.65 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | chloro-dimethyl-(1,1,1,3,3-pentafluoropropan-2-yl)silane |
| SMILES | C[Si](C)(Cl)C(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H8ClF5Si/c1-12(2,6)3(4(7)8)5(9,10)11/h3-4H,1-2H3 |
| InChIKey | XQTZSRSCQFFWSQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.65 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|