About 1,3,3,4,6,6-hexafluoro-2-methylcyclohexa-1,4-diene
1,3,3,4,6,6-hexafluoro-2-methylcyclohexa-1,4-diene (PubChem CID 23264383) has the molecular formula C7H4F6
and a molecular weight of 202.10 g/mol. Its IUPAC name is 1,3,3,4,6,6-hexafluoro-2-methylcyclohexa-1,4-diene.
Analyze 1,3,3,4,6,6-hexafluoro-2-methylcyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,3,4,6,6-hexafluoro-2-methylcyclohexa-1,4-diene?
The IUPAC name of 1,3,3,4,6,6-hexafluoro-2-methylcyclohexa-1,4-diene (CID 23264383) is 1,3,3,4,6,6-hexafluoro-2-methylcyclohexa-1,4-diene.
What is the SMILES notation for 1,3,3,4,6,6-hexafluoro-2-methylcyclohexa-1,4-diene?
The canonical SMILES for 1,3,3,4,6,6-hexafluoro-2-methylcyclohexa-1,4-diene is CC1=C(F)C(F)(F)C=C(F)C1(F)F.
What is the InChIKey of 1,3,3,4,6,6-hexafluoro-2-methylcyclohexa-1,4-diene?
The InChIKey is YDNFCZLHSHVPHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F6/c1-3-5(9)6(10,11)2-4(8)7(3,12)13/h2H,1H3.
What are the key properties of 1,3,3,4,6,6-hexafluoro-2-methylcyclohexa-1,4-diene?
1,3,3,4,6,6-hexafluoro-2-methylcyclohexa-1,4-diene has a molecular weight of 202.10 g/mol, XLogP of 3.37, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,3,4,6,6-hexafluoro-2-methylcyclohexa-1,4-diene is sourced from PubChem (CID 23264383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).