C11H10O5 — CID 23264691
[(1S,2R,6S,7S)-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-8-yl] acetate (PubChem CID 23264691) has the molecular formula C11H10O5 and a molecular weight of 222.20 g/mol. Its IUPAC name is [(1S,2R,6S,7S)-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-8-yl] acetate.
| Compound Name | [(1S,2R,6S,7S)-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-8-yl] acetate |
|---|---|
| PubChem CID | 23264691 |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | [(1S,2R,6S,7S)-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-8-yl] acetate |
| SMILES | CC(=O)OC1=C[C@@H]2C[C@H]1[C@@H]1C(=O)OC(=O)[C@@H]12 |
| InChI | InChI=1S/C11H10O5/c1-4(12)15-7-3-5-2-6(7)9-8(5)10(13)16-11(9)14/h3,5-6,8-9H,2H2,1H3/t5-,6+,8+,9-/m0/s1 |
| InChIKey | DXTJIPZSMFCJKJ-LWIVVEGESA-N |
| XLogP | 0.40 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|