C12H8F4O — CID 23264801
5,6,7,8-tetrafluoro-3,3a,4,8b-tetrahydro-1H-cyclopenta[a]inden-2-one (PubChem CID 23264801) has the molecular formula C12H8F4O and a molecular weight of 244.19 g/mol. Its IUPAC name is 5,6,7,8-tetrafluoro-3,3a,4,8b-tetrahydro-1H-cyclopenta[a]inden-2-one.
| Compound Name | 5,6,7,8-tetrafluoro-3,3a,4,8b-tetrahydro-1H-cyclopenta[a]inden-2-one |
|---|---|
| PubChem CID | 23264801 |
| Molecular Formula | C12H8F4O |
| Molecular Weight | 244.19 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 5,6,7,8-tetrafluoro-3,3a,4,8b-tetrahydro-1H-cyclopenta[a]inden-2-one |
| SMILES | O=C1CC2Cc3c(F)c(F)c(F)c(F)c3C2C1 |
| InChI | InChI=1S/C12H8F4O/c13-9-7-2-4-1-5(17)3-6(4)8(7)10(14)12(16)11(9)15/h4,6H,1-3H2 |
| InChIKey | HYPZXCSCOFKPSY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|