C12H10F6 — CID 23264815
1-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-3a,4,7,7a-tetrahydroindene (PubChem CID 23264815) has the molecular formula C12H10F6 and a molecular weight of 268.20 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-3a,4,7,7a-tetrahydroindene.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-3a,4,7,7a-tetrahydroindene |
|---|---|
| PubChem CID | 23264815 |
| Molecular Formula | C12H10F6 |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-3a,4,7,7a-tetrahydroindene |
| SMILES | FC(F)(F)C(=C1C=CC2CC=CCC12)C(F)(F)F |
| InChI | InChI=1S/C12H10F6/c13-11(14,15)10(12(16,17)18)9-6-5-7-3-1-2-4-8(7)9/h1-2,5-8H,3-4H2 |
| InChIKey | ZQVFKQSCEKLVRN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|